About (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide
(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide (PubChem CID 3046718) has the molecular formula C22H26INO2
and a molecular weight of 463.36 g/mol. Its IUPAC name is (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide.
Molecular Properties
| Compound Name | (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide |
| PubChem CID | 3046718 |
| Molecular Formula | C22H26INO2 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide |
| SMILES | C[N+]12CCC(CC1)C(OC(=O)C(c1ccccc1)c1ccccc1)C2.[I-] |
| InChI | InChI=1S/C22H26NO2.HI/c1-23-14-12-17(13-15-23)20(16-23)25-22(24)21(18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,17,20-21H,12-16H2,1H3;1H/q+1;/p-1 |
| InChIKey | XTUKWUMTJWLTSV-UHFFFAOYSA-M |
| XLogP | 0.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide?
The IUPAC name of (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide (CID 3046718) is (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide.
What is the SMILES notation for (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide?
The canonical SMILES for (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide is C[N+]12CCC(CC1)C(OC(=O)C(c1ccccc1)c1ccccc1)C2.[I-].
What is the InChIKey of (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide?
The InChIKey is XTUKWUMTJWLTSV-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H26NO2.HI/c1-23-14-12-17(13-15-23)20(16-23)25-22(24)21(18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,17,20-21H,12-16H2,1H3;1H/q+1;/p-1.
What are the key properties of (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide?
(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide has a molecular weight of 463.36 g/mol, XLogP of 0.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl) 2,2-diphenylacetate iodide is sourced from PubChem (CID 3046718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).