About 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine
2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine (PubChem CID 3046824) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine.
Molecular Properties
| Compound Name | 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine |
| PubChem CID | 3046824 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine |
| SMILES | Cc1nc2c(c(N)c1C)CCC2 |
| InChI | InChI=1S/C10H14N2/c1-6-7(2)12-9-5-3-4-8(9)10(6)11/h3-5H2,1-2H3,(H2,11,12) |
| InChIKey | XCACCLNWIIMXHQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine?
The IUPAC name of 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine (CID 3046824) is 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine.
What is the SMILES notation for 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine?
The canonical SMILES for 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine is Cc1nc2c(c(N)c1C)CCC2.
What is the InChIKey of 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine?
The InChIKey is XCACCLNWIIMXHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-6-7(2)12-9-5-3-4-8(9)10(6)11/h3-5H2,1-2H3,(H2,11,12).
What are the key properties of 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine?
2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine has a molecular weight of 162.24 g/mol, XLogP of 1.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine is sourced from PubChem (CID 3046824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).