About 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride
2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride (PubChem CID 3046842) has the molecular formula C24H25ClN2O
and a molecular weight of 392.93 g/mol. Its IUPAC name is 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride.
Molecular Properties
| Compound Name | 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride |
| PubChem CID | 3046842 |
| Molecular Formula | C24H25ClN2O |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride |
| SMILES | Cl.O=C(C(c1ccccc1)c1ccccc1)N1CCCC[C@H]1c1cccnc1 |
| InChI | InChI=1S/C24H24N2O.ClH/c27-24(26-17-8-7-15-22(26)21-14-9-16-25-18-21)23(19-10-3-1-4-11-19)20-12-5-2-6-13-20;/h1-6,9-14,16,18,22-23H,7-8,15,17H2;1H/t22-;/m0./s1 |
| InChIKey | KVKCUCWVDAZSIT-FTBISJDPSA-N |
| XLogP | 5.39 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride?
The IUPAC name of 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride (CID 3046842) is 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride.
What is the SMILES notation for 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride?
The canonical SMILES for 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride is Cl.O=C(C(c1ccccc1)c1ccccc1)N1CCCC[C@H]1c1cccnc1.
What is the InChIKey of 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride?
The InChIKey is KVKCUCWVDAZSIT-FTBISJDPSA-N. The full InChI is InChI=1S/C24H24N2O.ClH/c27-24(26-17-8-7-15-22(26)21-14-9-16-25-18-21)23(19-10-3-1-4-11-19)20-12-5-2-6-13-20;/h1-6,9-14,16,18,22-23H,7-8,15,17H2;1H/t22-;/m0./s1.
What are the key properties of 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride?
2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride has a molecular weight of 392.93 g/mol, XLogP of 5.39, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diphenyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethanone;hydrochloride is sourced from PubChem (CID 3046842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).