About 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one
5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 3046892) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one |
| PubChem CID | 3046892 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | CCc1ccccc1CC1CNC(=O)O1 |
| InChI | InChI=1S/C12H15NO2/c1-2-9-5-3-4-6-10(9)7-11-8-13-12(14)15-11/h3-6,11H,2,7-8H2,1H3,(H,13,14) |
| InChIKey | NVPGBJBIKHYPLL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one?
The IUPAC name of 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one (CID 3046892) is 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one is CCc1ccccc1CC1CNC(=O)O1.
What is the InChIKey of 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one?
The InChIKey is NVPGBJBIKHYPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-2-9-5-3-4-6-10(9)7-11-8-13-12(14)15-11/h3-6,11H,2,7-8H2,1H3,(H,13,14).
What are the key properties of 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one?
5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one has a molecular weight of 205.26 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-ethylphenyl)methyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 3046892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).