C22H26N2O3 — CID 30469965
3-(1,3-benzodioxol-5-yl)-1-(4-benzyl-1,4-diazepan-1-yl)propan-1-one (PubChem CID 30469965) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-(4-benzyl-1,4-diazepan-1-yl)propan-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-(4-benzyl-1,4-diazepan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 30469965 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-(4-benzyl-1,4-diazepan-1-yl)propan-1-one |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)N1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26N2O3/c25-22(10-8-18-7-9-20-21(15-18)27-17-26-20)24-12-4-11-23(13-14-24)16-19-5-2-1-3-6-19/h1-3,5-7,9,15H,4,8,10-14,16-17H2 |
| InChIKey | FTDPEDIHONYNIL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |