C19H26ClN5O5 — CID 3047123
7-[3-[[1-(3,4-dihydroxyphenyl)-1-hydroxypropan-2-yl]amino]propyl]-1,3-dimethylpurine-2,6-dione;hydrochloride (PubChem CID 3047123) has the molecular formula C19H26ClN5O5 and a molecular weight of 439.90 g/mol. Its IUPAC name is 7-[3-[[1-(3,4-dihydroxyphenyl)-1-hydroxypropan-2-yl]amino]propyl]-1,3-dimethylpurine-2,6-dione;hydrochloride.
| Compound Name | 7-[3-[[1-(3,4-dihydroxyphenyl)-1-hydroxypropan-2-yl]amino]propyl]-1,3-dimethylpurine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 3047123 |
| Molecular Formula | C19H26ClN5O5 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 7-[3-[[1-(3,4-dihydroxyphenyl)-1-hydroxypropan-2-yl]amino]propyl]-1,3-dimethylpurine-2,6-dione;hydrochloride |
| SMILES | CC(NCCCn1cnc2c1c(=O)n(C)c(=O)n2C)C(O)c1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C19H25N5O5.ClH/c1-11(16(27)12-5-6-13(25)14(26)9-12)20-7-4-8-24-10-21-17-15(24)18(28)23(3)19(29)22(17)2;/h5-6,9-11,16,20,25-27H,4,7-8H2,1-3H3;1H |
| InChIKey | GWCHJXZUWUFRNY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 134.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|