C26H50N2O2+2 — CID 3047191
[(1R,8R)-4-[10-[(1R,8R)-1-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-4-yl]decyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-1-yl]methanol (PubChem CID 3047191) has the molecular formula C26H50N2O2+2 and a molecular weight of 422.70 g/mol. Its IUPAC name is [(1R,8R)-4-[10-[(1R,8R)-1-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-4-yl]decyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-1-yl]methanol.
| Compound Name | [(1R,8R)-4-[10-[(1R,8R)-1-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-4-yl]decyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-1-yl]methanol |
|---|---|
| PubChem CID | 3047191 |
| Molecular Formula | C26H50N2O2+2 |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.39 |
| IUPAC Name | [(1R,8R)-4-[10-[(1R,8R)-1-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-4-yl]decyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-1-yl]methanol |
| SMILES | OC[C@@H]1CC[N+]2(CCCCCCCCCC[N+]34CCC[C@@H]3[C@H](CO)CC4)CCC[C@H]12 |
| InChI | InChI=1S/C26H50N2O2/c29-21-23-13-19-27(17-9-11-25(23)27)15-7-5-3-1-2-4-6-8-16-28-18-10-12-26(28)24(22-30)14-20-28/h23-26,29-30H,1-22H2/q+2/t23-,24-,25+,26+,27?,28?/m0/s1 |
| InChIKey | SDYQWERNUIKHGQ-JSCDBZNJSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|