About (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate
(4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate (PubChem CID 3047356) has the molecular formula C15H15ClO3S
and a molecular weight of 310.80 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate.
Molecular Properties
| Compound Name | (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate |
| PubChem CID | 3047356 |
| Molecular Formula | C15H15ClO3S |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)Cc2ccccc2)cc(C)c1Cl |
| InChI | InChI=1S/C15H15ClO3S/c1-11-8-14(9-12(2)15(11)16)19-20(17,18)10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3 |
| InChIKey | KREQVZKYTLUCFC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate?
The IUPAC name of (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate (CID 3047356) is (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate.
What is the SMILES notation for (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate?
The canonical SMILES for (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate is Cc1cc(OS(=O)(=O)Cc2ccccc2)cc(C)c1Cl.
What is the InChIKey of (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate?
The InChIKey is KREQVZKYTLUCFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClO3S/c1-11-8-14(9-12(2)15(11)16)19-20(17,18)10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3.
What are the key properties of (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate?
(4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate has a molecular weight of 310.80 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3,5-dimethylphenyl) phenylmethanesulfonate is sourced from PubChem (CID 3047356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).