About (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate
(4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate (PubChem CID 3047363) has the molecular formula C16H17ClO3S
and a molecular weight of 324.83 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate.
Molecular Properties
| Compound Name | (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate |
| PubChem CID | 3047363 |
| Molecular Formula | C16H17ClO3S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate |
| SMILES | Cc1cccc(S(=O)(=O)Oc2cc(C)c(Cl)c(C)c2)c1C |
| InChI | InChI=1S/C16H17ClO3S/c1-10-6-5-7-15(13(10)4)21(18,19)20-14-8-11(2)16(17)12(3)9-14/h5-9H,1-4H3 |
| InChIKey | XOIYVJIRWZIZGX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate?
The IUPAC name of (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate (CID 3047363) is (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate.
What is the SMILES notation for (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate?
The canonical SMILES for (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate is Cc1cccc(S(=O)(=O)Oc2cc(C)c(Cl)c(C)c2)c1C.
What is the InChIKey of (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate?
The InChIKey is XOIYVJIRWZIZGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClO3S/c1-10-6-5-7-15(13(10)4)21(18,19)20-14-8-11(2)16(17)12(3)9-14/h5-9H,1-4H3.
What are the key properties of (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate?
(4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate has a molecular weight of 324.83 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3,5-dimethylphenyl) 2,3-dimethylbenzenesulfonate is sourced from PubChem (CID 3047363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).