About 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride
1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride (PubChem CID 3047372) has the molecular formula C19H26ClNO4
and a molecular weight of 367.87 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride |
| PubChem CID | 3047372 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride |
| SMILES | COc1ccc(CCNCC(O)COc2ccccc2)cc1OC.Cl |
| InChI | InChI=1S/C19H25NO4.ClH/c1-22-18-9-8-15(12-19(18)23-2)10-11-20-13-16(21)14-24-17-6-4-3-5-7-17;/h3-9,12,16,20-21H,10-11,13-14H2,1-2H3;1H |
| InChIKey | YTKCHTIAZIFUSE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride?
The IUPAC name of 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride (CID 3047372) is 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride.
What is the SMILES notation for 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride?
The canonical SMILES for 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride is COc1ccc(CCNCC(O)COc2ccccc2)cc1OC.Cl.
What is the InChIKey of 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride?
The InChIKey is YTKCHTIAZIFUSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO4.ClH/c1-22-18-9-8-15(12-19(18)23-2)10-11-20-13-16(21)14-24-17-6-4-3-5-7-17;/h3-9,12,16,20-21H,10-11,13-14H2,1-2H3;1H.
What are the key properties of 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride?
1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride has a molecular weight of 367.87 g/mol, XLogP of 2.70, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenoxypropan-2-ol;hydrochloride is sourced from PubChem (CID 3047372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).