C5H9N3S — CID 3047402
N,N,5-trimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 3047402) has the molecular formula C5H9N3S and a molecular weight of 143.21 g/mol. Its IUPAC name is N,N,5-trimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N,N,5-trimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 3047402 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | N,N,5-trimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C5H9N3S/c1-4-6-7-5(9-4)8(2)3/h1-3H3 |
| InChIKey | BLWGGGOOIMHFRY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |