About 2-butoxy-2,6-dimethylpyran
2-butoxy-2,6-dimethylpyran (PubChem CID 3047542) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-butoxy-2,6-dimethylpyran.
Molecular Properties
| Compound Name | 2-butoxy-2,6-dimethylpyran |
| PubChem CID | 3047542 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-butoxy-2,6-dimethylpyran |
| SMILES | CCCCOC1(C)C=CC=C(C)O1 |
| InChI | InChI=1S/C11H18O2/c1-4-5-9-12-11(3)8-6-7-10(2)13-11/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | YAURLTGVECUOOA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-2,6-dimethylpyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-2,6-dimethylpyran?
The IUPAC name of 2-butoxy-2,6-dimethylpyran (CID 3047542) is 2-butoxy-2,6-dimethylpyran.
What is the SMILES notation for 2-butoxy-2,6-dimethylpyran?
The canonical SMILES for 2-butoxy-2,6-dimethylpyran is CCCCOC1(C)C=CC=C(C)O1.
What is the InChIKey of 2-butoxy-2,6-dimethylpyran?
The InChIKey is YAURLTGVECUOOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-4-5-9-12-11(3)8-6-7-10(2)13-11/h6-8H,4-5,9H2,1-3H3.
What are the key properties of 2-butoxy-2,6-dimethylpyran?
2-butoxy-2,6-dimethylpyran has a molecular weight of 182.26 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-2,6-dimethylpyran is sourced from PubChem (CID 3047542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).