About 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride
2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride (PubChem CID 3047555) has the molecular formula C18H34ClN
and a molecular weight of 299.93 g/mol. Its IUPAC name is 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride |
| PubChem CID | 3047555 |
| Molecular Formula | C18H34ClN |
| Molecular Weight | 299.93 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride |
| SMILES | C1CCC(C(CC2CCCN2)C2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C18H33N.ClH/c1-3-8-15(9-4-1)18(14-17-12-7-13-19-17)16-10-5-2-6-11-16;/h15-19H,1-14H2;1H |
| InChIKey | JEHNFUFWVHOHHQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride?
The IUPAC name of 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride (CID 3047555) is 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride.
What is the SMILES notation for 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride?
The canonical SMILES for 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride is C1CCC(C(CC2CCCN2)C2CCCCC2)CC1.Cl.
What is the InChIKey of 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride?
The InChIKey is JEHNFUFWVHOHHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N.ClH/c1-3-8-15(9-4-1)18(14-17-12-7-13-19-17)16-10-5-2-6-11-16;/h15-19H,1-14H2;1H.
What are the key properties of 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride?
2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride has a molecular weight of 299.93 g/mol, XLogP of 5.33, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dicyclohexylethyl)pyrrolidine;hydrochloride is sourced from PubChem (CID 3047555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).