About 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride
2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride (PubChem CID 3047918) has the molecular formula C8H17ClN2S
and a molecular weight of 208.76 g/mol. Its IUPAC name is 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride |
| PubChem CID | 3047918 |
| Molecular Formula | C8H17ClN2S |
| Molecular Weight | 208.76 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride |
| SMILES | CN1CC=C(SCCN)CC1.Cl |
| InChI | InChI=1S/C8H16N2S.ClH/c1-10-5-2-8(3-6-10)11-7-4-9;/h2H,3-7,9H2,1H3;1H |
| InChIKey | ZFBIIOSWGIPPEW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.76 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride?
The IUPAC name of 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride (CID 3047918) is 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride.
What is the SMILES notation for 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride?
The canonical SMILES for 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride is CN1CC=C(SCCN)CC1.Cl.
What is the InChIKey of 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride?
The InChIKey is ZFBIIOSWGIPPEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S.ClH/c1-10-5-2-8(3-6-10)11-7-4-9;/h2H,3-7,9H2,1H3;1H.
What are the key properties of 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride?
2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride has a molecular weight of 208.76 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)sulfanyl]ethanamine;hydrochloride is sourced from PubChem (CID 3047918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).