About 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride
3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride (PubChem CID 3047987) has the molecular formula C18H18Cl3NS
and a molecular weight of 386.78 g/mol. Its IUPAC name is 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride |
| PubChem CID | 3047987 |
| Molecular Formula | C18H18Cl3NS |
| Molecular Weight | 386.78 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride |
| SMILES | CN(C)CCC=C1c2cc(Cl)ccc2Sc2ccc(Cl)cc21.Cl |
| InChI | InChI=1S/C18H17Cl2NS.ClH/c1-21(2)9-3-4-14-15-10-12(19)5-7-17(15)22-18-8-6-13(20)11-16(14)18;/h4-8,10-11H,3,9H2,1-2H3;1H |
| InChIKey | CUVMRUIWQBLBEX-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.78 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride?
The IUPAC name of 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride (CID 3047987) is 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride.
What is the SMILES notation for 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride?
The canonical SMILES for 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride is CN(C)CCC=C1c2cc(Cl)ccc2Sc2ccc(Cl)cc21.Cl.
What is the InChIKey of 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride?
The InChIKey is CUVMRUIWQBLBEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2NS.ClH/c1-21(2)9-3-4-14-15-10-12(19)5-7-17(15)22-18-8-6-13(20)11-16(14)18;/h4-8,10-11H,3,9H2,1-2H3;1H.
What are the key properties of 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride?
3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride has a molecular weight of 386.78 g/mol, XLogP of 6.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,7-dichlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride is sourced from PubChem (CID 3047987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).