C28H30N2O2 — CID 3048029
[(1S,9R,13R)-1,13-dimethyl-10-(2-phenylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] pyridine-3-carboxylate (PubChem CID 3048029) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is [(1S,9R,13R)-1,13-dimethyl-10-(2-phenylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] pyridine-3-carboxylate.
| Compound Name | [(1S,9R,13R)-1,13-dimethyl-10-(2-phenylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 3048029 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | [(1S,9R,13R)-1,13-dimethyl-10-(2-phenylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] pyridine-3-carboxylate |
| SMILES | C[C@H]1[C@H]2Cc3ccc(OC(=O)c4cccnc4)cc3[C@@]1(C)CCN2CCc1ccccc1 |
| InChI | InChI=1S/C28H30N2O2/c1-20-26-17-22-10-11-24(32-27(31)23-9-6-14-29-19-23)18-25(22)28(20,2)13-16-30(26)15-12-21-7-4-3-5-8-21/h3-11,14,18-20,26H,12-13,15-17H2,1-2H3/t20-,26+,28-/m0/s1 |
| InChIKey | IXBOJGHLETUNTB-GFNGZDJJSA-N |
| XLogP | 5.07 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|