C24H50Br2N2 — CID 3048051
1,1'-(Decane-1,10-diyl)bis(1-ethylpiperidin-1-ium) dibromide (PubChem CID 3048051) has the molecular formula C24H50Br2N2 and a molecular weight of 526.50 g/mol. Its IUPAC name is 1-ethyl-1-[10-(1-ethylpiperidin-1-ium-1-yl)decyl]piperidin-1-ium dibromide.
| Compound Name | 1,1'-(Decane-1,10-diyl)bis(1-ethylpiperidin-1-ium) dibromide |
|---|---|
| PubChem CID | 3048051 |
| Molecular Formula | C24H50Br2N2 |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 1-ethyl-1-[10-(1-ethylpiperidin-1-ium-1-yl)decyl]piperidin-1-ium dibromide |
| SMILES | CC[N+]1(CCCCC1)CCCCCCCCCC[N+]2(CCCCC2)CC.[Br-].[Br-] |
| InChI | InChI=1S/C24H50N2.2BrH/c1-3-25(21-15-11-16-22-25)19-13-9-7-5-6-8-10-14-20-26(4-2)23-17-12-18-24-26;;/h3-24H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | HKYGTNQCXCKJAW-UHFFFAOYSA-L |
| XLogP | — |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | 306 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|