About 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide
4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide (PubChem CID 3048055) has the molecular formula C14H30I2N2O
and a molecular weight of 496.22 g/mol. Its IUPAC name is 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide.
Molecular Properties
| Compound Name | 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide |
| PubChem CID | 3048055 |
| Molecular Formula | C14H30I2N2O |
| Molecular Weight | 496.22 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide |
| SMILES | C[N+]1(C)CCC(CC[N+]2(C)CCOCC2)CC1.[I-].[I-] |
| InChI | InChI=1S/C14H30N2O.2HI/c1-15(2)7-4-14(5-8-15)6-9-16(3)10-12-17-13-11-16;;/h14H,4-13H2,1-3H3;2*1H/q+2;;/p-2 |
| InChIKey | XWSYYWABEPNTFA-UHFFFAOYSA-L |
| XLogP | -4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.22 |
| LogP ≤ 5 | -4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide?
The IUPAC name of 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide (CID 3048055) is 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide.
What is the SMILES notation for 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide?
The canonical SMILES for 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide is C[N+]1(C)CCC(CC[N+]2(C)CCOCC2)CC1.[I-].[I-].
What is the InChIKey of 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide?
The InChIKey is XWSYYWABEPNTFA-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H30N2O.2HI/c1-15(2)7-4-14(5-8-15)6-9-16(3)10-12-17-13-11-16;;/h14H,4-13H2,1-3H3;2*1H/q+2;;/p-2.
What are the key properties of 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide?
4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide has a molecular weight of 496.22 g/mol, XLogP of -4.65, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-4-methylmorpholin-4-ium diiodide is sourced from PubChem (CID 3048055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).