C6H12N4O3 — CID 3048063
6-amino-5-(hydroxyamino)-1,3-dimethyl-1,3-diazinane-2,4-dione (PubChem CID 3048063) has the molecular formula C6H12N4O3 and a molecular weight of 188.19 g/mol. Its IUPAC name is 6-amino-5-(hydroxyamino)-1,3-dimethyl-1,3-diazinane-2,4-dione.
| Compound Name | 6-amino-5-(hydroxyamino)-1,3-dimethyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 3048063 |
| Molecular Formula | C6H12N4O3 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 6-amino-5-(hydroxyamino)-1,3-dimethyl-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)C(NO)C(N)N(C)C1=O |
| InChI | InChI=1S/C6H12N4O3/c1-9-4(7)3(8-13)5(11)10(2)6(9)12/h3-4,8,13H,7H2,1-2H3 |
| InChIKey | MRTGXVGVUMCCDV-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|