C32H36Br2N4 — CID 3048098
2-[6-(1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)hexyl]-1,9-dimethylpyrido[3,4-b]indol-2-ium dibromide (PubChem CID 3048098) has the molecular formula C32H36Br2N4 and a molecular weight of 636.48 g/mol. Its IUPAC name is 2-[6-(1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)hexyl]-1,9-dimethylpyrido[3,4-b]indol-2-ium dibromide.
| Compound Name | 2-[6-(1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)hexyl]-1,9-dimethylpyrido[3,4-b]indol-2-ium dibromide |
|---|---|
| PubChem CID | 3048098 |
| Molecular Formula | C32H36Br2N4 |
| Molecular Weight | 636.48 g/mol |
| Exact Mass | 634.13 |
| IUPAC Name | 2-[6-(1,9-dimethylpyrido[3,4-b]indol-2-ium-2-yl)hexyl]-1,9-dimethylpyrido[3,4-b]indol-2-ium dibromide |
| SMILES | Cc1c2c(cc[n+]1CCCCCC[n+]1ccc3c4ccccc4n(C)c3c1C)c1ccccc1n2C.[Br-].[Br-] |
| InChI | InChI=1S/C32H36N4.2BrH/c1-23-31-27(25-13-7-9-15-29(25)33(31)3)17-21-35(23)19-11-5-6-12-20-36-22-18-28-26-14-8-10-16-30(26)34(4)32(28)24(36)2;;/h7-10,13-18,21-22H,5-6,11-12,19-20H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | MVRCGPBVWLRGIP-UHFFFAOYSA-L |
| XLogP | 0.44 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.48 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|