About 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide
2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide (PubChem CID 3048281) has the molecular formula C12H28I2N2
and a molecular weight of 454.18 g/mol. Its IUPAC name is 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide.
Molecular Properties
| Compound Name | 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide |
| PubChem CID | 3048281 |
| Molecular Formula | C12H28I2N2 |
| Molecular Weight | 454.18 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide |
| SMILES | C[N+](C)(C)CCC1CC[N+](C)(C)CC1.[I-].[I-] |
| InChI | InChI=1S/C12H28N2.2HI/c1-13(2,3)9-6-12-7-10-14(4,5)11-8-12;;/h12H,6-11H2,1-5H3;2*1H/q+2;;/p-2 |
| InChIKey | LWVTVUWDPRDWKX-UHFFFAOYSA-L |
| XLogP | -4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.18 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide?
The IUPAC name of 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide (CID 3048281) is 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide.
What is the SMILES notation for 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide?
The canonical SMILES for 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide is C[N+](C)(C)CCC1CC[N+](C)(C)CC1.[I-].[I-].
What is the InChIKey of 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide?
The InChIKey is LWVTVUWDPRDWKX-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H28N2.2HI/c1-13(2,3)9-6-12-7-10-14(4,5)11-8-12;;/h12H,6-11H2,1-5H3;2*1H/q+2;;/p-2.
What are the key properties of 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide?
2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide has a molecular weight of 454.18 g/mol, XLogP of -4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl-trimethylazanium diiodide is sourced from PubChem (CID 3048281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).