C15H22BrN — CID 3048328
(1R,9S,13S)-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene;hydrobromide (PubChem CID 3048328) has the molecular formula C15H22BrN and a molecular weight of 296.25 g/mol. Its IUPAC name is (1R,9S,13S)-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene;hydrobromide.
| Compound Name | (1R,9S,13S)-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene;hydrobromide |
|---|---|
| PubChem CID | 3048328 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | (1R,9S,13S)-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene;hydrobromide |
| SMILES | Br.C[C@@H]1[C@@H]2Cc3ccccc3[C@]1(C)CCN2C |
| InChI | InChI=1S/C15H21N.BrH/c1-11-14-10-12-6-4-5-7-13(12)15(11,2)8-9-16(14)3;/h4-7,11,14H,8-10H2,1-3H3;1H/t11-,14+,15-;/m1./s1 |
| InChIKey | YMUQBPRSTIPGNF-IYPIUBNXSA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |