C23H27N3O3S — CID 30483407
(2R,3S)-1-(4-methylphenyl)-5-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-thiophen-2-ylpyrrolidine-3-carboxamide (PubChem CID 30483407) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is (2R,3S)-1-(4-methylphenyl)-5-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-thiophen-2-ylpyrrolidine-3-carboxamide.
| Compound Name | (2R,3S)-1-(4-methylphenyl)-5-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-thiophen-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 30483407 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (2R,3S)-1-(4-methylphenyl)-5-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-thiophen-2-ylpyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2C(=O)C[C@H](C(=O)NCCCN3CCCC3=O)[C@@H]2c2cccs2)cc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-16-7-9-17(10-8-16)26-21(28)15-18(22(26)19-5-3-14-30-19)23(29)24-11-4-13-25-12-2-6-20(25)27/h3,5,7-10,14,18,22H,2,4,6,11-13,15H2,1H3,(H,24,29)/t18-,22+/m0/s1 |
| InChIKey | PVTNSEGWHHORSX-PGRDOPGGSA-N |
| XLogP | 3.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|