About pyridin-1-ium-1-ylmethyl acetate chloride
pyridin-1-ium-1-ylmethyl acetate chloride (PubChem CID 3048408) has the molecular formula C8H10ClNO2
and a molecular weight of 187.63 g/mol. Its IUPAC name is pyridin-1-ium-1-ylmethyl acetate chloride.
Molecular Properties
| Compound Name | pyridin-1-ium-1-ylmethyl acetate chloride |
| PubChem CID | 3048408 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | pyridin-1-ium-1-ylmethyl acetate chloride |
| SMILES | CC(=O)OC[n+]1ccccc1.[Cl-] |
| InChI | InChI=1S/C8H10NO2.ClH/c1-8(10)11-7-9-5-3-2-4-6-9;/h2-6H,7H2,1H3;1H/q+1;/p-1 |
| InChIKey | VFGRQLDNDKEKTI-UHFFFAOYSA-M |
| XLogP | -2.50 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-1-ium-1-ylmethyl acetate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium-1-ylmethyl acetate chloride?
The IUPAC name of pyridin-1-ium-1-ylmethyl acetate chloride (CID 3048408) is pyridin-1-ium-1-ylmethyl acetate chloride.
What is the SMILES notation for pyridin-1-ium-1-ylmethyl acetate chloride?
The canonical SMILES for pyridin-1-ium-1-ylmethyl acetate chloride is CC(=O)OC[n+]1ccccc1.[Cl-].
What is the InChIKey of pyridin-1-ium-1-ylmethyl acetate chloride?
The InChIKey is VFGRQLDNDKEKTI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10NO2.ClH/c1-8(10)11-7-9-5-3-2-4-6-9;/h2-6H,7H2,1H3;1H/q+1;/p-1.
What are the key properties of pyridin-1-ium-1-ylmethyl acetate chloride?
pyridin-1-ium-1-ylmethyl acetate chloride has a molecular weight of 187.63 g/mol, XLogP of -2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium-1-ylmethyl acetate chloride is sourced from PubChem (CID 3048408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).