About formic acid;4-methyl-1,3-thiazol-2-amine
formic acid;4-methyl-1,3-thiazol-2-amine (PubChem CID 3048486) has the molecular formula C5H8N2O2S
and a molecular weight of 160.20 g/mol. Its IUPAC name is formic acid;4-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | formic acid;4-methyl-1,3-thiazol-2-amine |
| PubChem CID | 3048486 |
| Molecular Formula | C5H8N2O2S |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | formic acid;4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(N)n1.O=CO |
| InChI | InChI=1S/C4H6N2S.CH2O2/c1-3-2-7-4(5)6-3;2-1-3/h2H,1H3,(H2,5,6);1H,(H,2,3) |
| InChIKey | OCHGUHMHYXVVJX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;4-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;4-methyl-1,3-thiazol-2-amine?
The IUPAC name of formic acid;4-methyl-1,3-thiazol-2-amine (CID 3048486) is formic acid;4-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for formic acid;4-methyl-1,3-thiazol-2-amine?
The canonical SMILES for formic acid;4-methyl-1,3-thiazol-2-amine is Cc1csc(N)n1.O=CO.
What is the InChIKey of formic acid;4-methyl-1,3-thiazol-2-amine?
The InChIKey is OCHGUHMHYXVVJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2S.CH2O2/c1-3-2-7-4(5)6-3;2-1-3/h2H,1H3,(H2,5,6);1H,(H,2,3).
What are the key properties of formic acid;4-methyl-1,3-thiazol-2-amine?
formic acid;4-methyl-1,3-thiazol-2-amine has a molecular weight of 160.20 g/mol, XLogP of 0.73, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;4-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 3048486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).