About 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride
4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride (PubChem CID 3048687) has the molecular formula C19H26ClNO2
and a molecular weight of 335.88 g/mol. Its IUPAC name is 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride.
Molecular Properties
| Compound Name | 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride |
| PubChem CID | 3048687 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride |
| SMILES | CCCN(CCc1ccccc1)CCc1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C19H25NO2.ClH/c1-2-12-20(13-10-16-6-4-3-5-7-16)14-11-17-8-9-18(21)19(22)15-17;/h3-9,15,21-22H,2,10-14H2,1H3;1H |
| InChIKey | WOMKPQNZQZAFHW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride?
The IUPAC name of 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride (CID 3048687) is 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride.
What is the SMILES notation for 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride?
The canonical SMILES for 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride is CCCN(CCc1ccccc1)CCc1ccc(O)c(O)c1.Cl.
What is the InChIKey of 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride?
The InChIKey is WOMKPQNZQZAFHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO2.ClH/c1-2-12-20(13-10-16-6-4-3-5-7-16)14-11-17-8-9-18(21)19(22)15-17;/h3-9,15,21-22H,2,10-14H2,1H3;1H.
What are the key properties of 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride?
4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride has a molecular weight of 335.88 g/mol, XLogP of 4.02, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[2-phenylethyl(propyl)amino]ethyl]benzene-1,2-diol;hydrochloride is sourced from PubChem (CID 3048687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).