C14H10ClN3O — CID 3048696
8-chloro-4-phenyl-1H-1,2,4-benzotriazepin-5-one (PubChem CID 3048696) has the molecular formula C14H10ClN3O and a molecular weight of 271.71 g/mol. Its IUPAC name is 8-chloro-4-phenyl-1H-1,2,4-benzotriazepin-5-one.
| Compound Name | 8-chloro-4-phenyl-1H-1,2,4-benzotriazepin-5-one |
|---|---|
| PubChem CID | 3048696 |
| Molecular Formula | C14H10ClN3O |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 8-chloro-4-phenyl-1H-1,2,4-benzotriazepin-5-one |
| SMILES | O=C1c2ccc(Cl)cc2NN=CN1c1ccccc1 |
| InChI | InChI=1S/C14H10ClN3O/c15-10-6-7-12-13(8-10)17-16-9-18(14(12)19)11-4-2-1-3-5-11/h1-9,17H |
| InChIKey | GLBCSOYQWIXTOK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |