C22H41NO6S — CID 3048793
2-[bis(2-hydroxyethyl)amino]ethanol;2-decylbenzenesulfonic acid (PubChem CID 3048793) has the molecular formula C22H41NO6S and a molecular weight of 447.64 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;2-decylbenzenesulfonic acid.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;2-decylbenzenesulfonic acid |
|---|---|
| PubChem CID | 3048793 |
| Molecular Formula | C22H41NO6S |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;2-decylbenzenesulfonic acid |
| SMILES | CCCCCCCCCCc1ccccc1S(=O)(=O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C16H26O3S.C6H15NO3/c1-2-3-4-5-6-7-8-9-12-15-13-10-11-14-16(15)20(17,18)19;8-4-1-7(2-5-9)3-6-10/h10-11,13-14H,2-9,12H2,1H3,(H,17,18,19);8-10H,1-6H2 |
| InChIKey | LCVLDGJFBZHYOX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|