About 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone
1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone (PubChem CID 3048936) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone |
| PubChem CID | 3048936 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone |
| SMILES | CC(=O)N1CC2(CCN(C)C2)c2ccccc21 |
| InChI | InChI=1S/C14H18N2O/c1-11(17)16-10-14(7-8-15(2)9-14)12-5-3-4-6-13(12)16/h3-6H,7-10H2,1-2H3 |
| InChIKey | NFKVONBKZSTPAZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone?
The IUPAC name of 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone (CID 3048936) is 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone.
What is the SMILES notation for 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone?
The canonical SMILES for 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone is CC(=O)N1CC2(CCN(C)C2)c2ccccc21.
What is the InChIKey of 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone?
The InChIKey is NFKVONBKZSTPAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c1-11(17)16-10-14(7-8-15(2)9-14)12-5-3-4-6-13(12)16/h3-6H,7-10H2,1-2H3.
What are the key properties of 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone?
1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone has a molecular weight of 230.31 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1'-methylspiro[2H-indole-3,3'-pyrrolidine]-1-yl)ethanone is sourced from PubChem (CID 3048936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).