C11H16N4O2 — CID 3048966
1,3-dimethyl-6-prop-2-enyl-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 3048966) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1,3-dimethyl-6-prop-2-enyl-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-prop-2-enyl-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3048966 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1,3-dimethyl-6-prop-2-enyl-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | C=CCN1CNc2c(c(=O)n(C)c(=O)n2C)C1 |
| InChI | InChI=1S/C11H16N4O2/c1-4-5-15-6-8-9(12-7-15)13(2)11(17)14(3)10(8)16/h4,12H,1,5-7H2,2-3H3 |
| InChIKey | OYXMLLMDRSCTIZ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|