C15H21ClF3N — CID 3049034
1-propan-2-yl-3-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride (PubChem CID 3049034) has the molecular formula C15H21ClF3N and a molecular weight of 307.79 g/mol. Its IUPAC name is 1-propan-2-yl-3-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride.
| Compound Name | 1-propan-2-yl-3-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 3049034 |
| Molecular Formula | C15H21ClF3N |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-propan-2-yl-3-[3-(trifluoromethyl)phenyl]piperidine;hydrochloride |
| SMILES | CC(C)N1CCCC(c2cccc(C(F)(F)F)c2)C1.Cl |
| InChI | InChI=1S/C15H20F3N.ClH/c1-11(2)19-8-4-6-13(10-19)12-5-3-7-14(9-12)15(16,17)18;/h3,5,7,9,11,13H,4,6,8,10H2,1-2H3;1H |
| InChIKey | SRLGWTWTXWKNFL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |