About [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride
[2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride (PubChem CID 3049044) has the molecular formula C25H30ClNO2
and a molecular weight of 411.97 g/mol. Its IUPAC name is [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride.
Molecular Properties
| Compound Name | [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride |
| PubChem CID | 3049044 |
| Molecular Formula | C25H30ClNO2 |
| Molecular Weight | 411.97 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride |
| SMILES | CCC(=O)OC1(c2ccccc2)CC(C)N(CC#Cc2ccccc2)CC1C.Cl |
| InChI | InChI=1S/C25H29NO2.ClH/c1-4-24(27)28-25(23-15-9-6-10-16-23)18-21(3)26(19-20(25)2)17-11-14-22-12-7-5-8-13-22;/h5-10,12-13,15-16,20-21H,4,17-19H2,1-3H3;1H |
| InChIKey | NWBOAWNFWOMUEA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.97 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride?
The IUPAC name of [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride (CID 3049044) is [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride.
What is the SMILES notation for [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride?
The canonical SMILES for [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride is CCC(=O)OC1(c2ccccc2)CC(C)N(CC#Cc2ccccc2)CC1C.Cl.
What is the InChIKey of [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride?
The InChIKey is NWBOAWNFWOMUEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29NO2.ClH/c1-4-24(27)28-25(23-15-9-6-10-16-23)18-21(3)26(19-20(25)2)17-11-14-22-12-7-5-8-13-22;/h5-10,12-13,15-16,20-21H,4,17-19H2,1-3H3;1H.
What are the key properties of [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride?
[2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride has a molecular weight of 411.97 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate;hydrochloride is sourced from PubChem (CID 3049044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).