About 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine
3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine (PubChem CID 3049051) has the molecular formula C20H35NSi
and a molecular weight of 317.59 g/mol. Its IUPAC name is 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine |
| PubChem CID | 3049051 |
| Molecular Formula | C20H35NSi |
| Molecular Weight | 317.59 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCC[Si](C)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H35NSi/c1-4-21(5-2)17-12-18-22(3,19-13-8-6-9-14-19)20-15-10-7-11-16-20/h6,8-9,13-14,20H,4-5,7,10-12,15-18H2,1-3H3 |
| InChIKey | OGIFLTKYIJWYMA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine?
The IUPAC name of 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine (CID 3049051) is 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine.
What is the SMILES notation for 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine?
The canonical SMILES for 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine is CCN(CC)CCC[Si](C)(c1ccccc1)C1CCCCC1.
What is the InChIKey of 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine?
The InChIKey is OGIFLTKYIJWYMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35NSi/c1-4-21(5-2)17-12-18-22(3,19-13-8-6-9-14-19)20-15-10-7-11-16-20/h6,8-9,13-14,20H,4-5,7,10-12,15-18H2,1-3H3.
What are the key properties of 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine?
3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine has a molecular weight of 317.59 g/mol, XLogP of 5.04, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexyl-methyl-phenylsilyl)-N,N-diethylpropan-1-amine is sourced from PubChem (CID 3049051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).