About N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride
N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride (PubChem CID 3049218) has the molecular formula C11H17ClN2O
and a molecular weight of 228.72 g/mol. Its IUPAC name is N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride.
Molecular Properties
| Compound Name | N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride |
| PubChem CID | 3049218 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride |
| SMILES | CCN/C(=N\C)c1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C11H16N2O.ClH/c1-4-13-11(12-2)9-5-7-10(14-3)8-6-9;/h5-8H,4H2,1-3H3,(H,12,13);1H |
| InChIKey | CLKHMQIDNGMOLB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride?
The IUPAC name of N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride (CID 3049218) is N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride.
What is the SMILES notation for N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride?
The canonical SMILES for N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride is CCN/C(=N\C)c1ccc(OC)cc1.Cl.
What is the InChIKey of N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride?
The InChIKey is CLKHMQIDNGMOLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O.ClH/c1-4-13-11(12-2)9-5-7-10(14-3)8-6-9;/h5-8H,4H2,1-3H3,(H,12,13);1H.
What are the key properties of N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride?
N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride has a molecular weight of 228.72 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-methoxy-N'-methylbenzenecarboximidamide;hydrochloride is sourced from PubChem (CID 3049218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).