About 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride
4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride (PubChem CID 3049232) has the molecular formula C14H14Cl2N2
and a molecular weight of 281.19 g/mol. Its IUPAC name is 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride |
| PubChem CID | 3049232 |
| Molecular Formula | C14H14Cl2N2 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride |
| SMILES | C/N=C(/Nc1ccccc1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C14H13ClN2.ClH/c1-16-14(11-7-9-12(15)10-8-11)17-13-5-3-2-4-6-13;/h2-10H,1H3,(H,16,17);1H |
| InChIKey | CRXCPZWRDZEDMM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride?
The IUPAC name of 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride (CID 3049232) is 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride.
What is the SMILES notation for 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride?
The canonical SMILES for 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride is C/N=C(/Nc1ccccc1)c1ccc(Cl)cc1.Cl.
What is the InChIKey of 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride?
The InChIKey is CRXCPZWRDZEDMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN2.ClH/c1-16-14(11-7-9-12(15)10-8-11)17-13-5-3-2-4-6-13;/h2-10H,1H3,(H,16,17);1H.
What are the key properties of 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride?
4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride has a molecular weight of 281.19 g/mol, XLogP of 4.25, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N'-methyl-N-phenylbenzenecarboximidamide;hydrochloride is sourced from PubChem (CID 3049232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).