About N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride
N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride (PubChem CID 3049266) has the molecular formula C11H13ClN2O
and a molecular weight of 224.69 g/mol. Its IUPAC name is N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride |
| PubChem CID | 3049266 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride |
| SMILES | CNCc1ncc(-c2ccccc2)o1.Cl |
| InChI | InChI=1S/C11H12N2O.ClH/c1-12-8-11-13-7-10(14-11)9-5-3-2-4-6-9;/h2-7,12H,8H2,1H3;1H |
| InChIKey | SPQWGFGYBILRRK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride?
The IUPAC name of N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride (CID 3049266) is N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride.
What is the SMILES notation for N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride?
The canonical SMILES for N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride is CNCc1ncc(-c2ccccc2)o1.Cl.
What is the InChIKey of N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride?
The InChIKey is SPQWGFGYBILRRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O.ClH/c1-12-8-11-13-7-10(14-11)9-5-3-2-4-6-9;/h2-7,12H,8H2,1H3;1H.
What are the key properties of N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride?
N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride has a molecular weight of 224.69 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(5-phenyl-1,3-oxazol-2-yl)methanamine;hydrochloride is sourced from PubChem (CID 3049266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).