About N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride
N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride (PubChem CID 3049301) has the molecular formula C12H14Cl2N2O
and a molecular weight of 273.16 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride |
| PubChem CID | 3049301 |
| Molecular Formula | C12H14Cl2N2O |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride |
| SMILES | CCNCc1ncc(-c2ccc(Cl)cc2)o1.Cl |
| InChI | InChI=1S/C12H13ClN2O.ClH/c1-2-14-8-12-15-7-11(16-12)9-3-5-10(13)6-4-9;/h3-7,14H,2,8H2,1H3;1H |
| InChIKey | QNYFWCURWNVXPO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride?
The IUPAC name of N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride (CID 3049301) is N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride.
What is the SMILES notation for N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride?
The canonical SMILES for N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride is CCNCc1ncc(-c2ccc(Cl)cc2)o1.Cl.
What is the InChIKey of N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride?
The InChIKey is QNYFWCURWNVXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O.ClH/c1-2-14-8-12-15-7-11(16-12)9-3-5-10(13)6-4-9;/h3-7,14H,2,8H2,1H3;1H.
What are the key properties of N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride?
N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride has a molecular weight of 273.16 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]ethanamine;hydrochloride is sourced from PubChem (CID 3049301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).