C18H22N2O4 — CID 3049339
ethyl (4S,5R,6S)-6-hydroxy-2,6-dimethyl-3-oxo-4-phenyl-1,4,5,7-tetrahydroindazole-5-carboxylate (PubChem CID 3049339) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is ethyl (4S,5R,6S)-6-hydroxy-2,6-dimethyl-3-oxo-4-phenyl-1,4,5,7-tetrahydroindazole-5-carboxylate.
| Compound Name | ethyl (4S,5R,6S)-6-hydroxy-2,6-dimethyl-3-oxo-4-phenyl-1,4,5,7-tetrahydroindazole-5-carboxylate |
|---|---|
| PubChem CID | 3049339 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | ethyl (4S,5R,6S)-6-hydroxy-2,6-dimethyl-3-oxo-4-phenyl-1,4,5,7-tetrahydroindazole-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccccc2)c2c([nH]n(C)c2=O)C[C@]1(C)O |
| InChI | InChI=1S/C18H22N2O4/c1-4-24-17(22)15-13(11-8-6-5-7-9-11)14-12(10-18(15,2)23)19-20(3)16(14)21/h5-9,13,15,19,23H,4,10H2,1-3H3/t13-,15-,18-/m0/s1 |
| InChIKey | MOWSFNJEZAADQZ-YEWWUXTCSA-N |
| XLogP | 1.33 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |