C22H28N2O6 — CID 3049341
ethyl (4S,5R,6S)-3-(3-ethoxy-3-oxopropoxy)-6-hydroxy-6-methyl-4-phenyl-1,4,5,7-tetrahydroindazole-5-carboxylate (PubChem CID 3049341) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is ethyl (4S,5R,6S)-3-(3-ethoxy-3-oxopropoxy)-6-hydroxy-6-methyl-4-phenyl-1,4,5,7-tetrahydroindazole-5-carboxylate.
| Compound Name | ethyl (4S,5R,6S)-3-(3-ethoxy-3-oxopropoxy)-6-hydroxy-6-methyl-4-phenyl-1,4,5,7-tetrahydroindazole-5-carboxylate |
|---|---|
| PubChem CID | 3049341 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | ethyl (4S,5R,6S)-3-(3-ethoxy-3-oxopropoxy)-6-hydroxy-6-methyl-4-phenyl-1,4,5,7-tetrahydroindazole-5-carboxylate |
| SMILES | CCOC(=O)CCOc1n[nH]c2c1[C@H](c1ccccc1)[C@@H](C(=O)OCC)[C@@](C)(O)C2 |
| InChI | InChI=1S/C22H28N2O6/c1-4-28-16(25)11-12-30-20-18-15(23-24-20)13-22(3,27)19(21(26)29-5-2)17(18)14-9-7-6-8-10-14/h6-10,17,19,27H,4-5,11-13H2,1-3H3,(H,23,24)/t17-,19-,22-/m0/s1 |
| InChIKey | BAEDLKICINEWML-JLMWRMLUSA-N |
| XLogP | 2.36 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |