C11H6Br2N4O2 — CID 3049418
methyl 3,5-dibromo-4-[2-(dicyanomethylidene)hydrazinyl]benzoate (PubChem CID 3049418) has the molecular formula C11H6Br2N4O2 and a molecular weight of 386.00 g/mol. Its IUPAC name is methyl 3,5-dibromo-4-[2-(dicyanomethylidene)hydrazinyl]benzoate.
| Compound Name | methyl 3,5-dibromo-4-[2-(dicyanomethylidene)hydrazinyl]benzoate |
|---|---|
| PubChem CID | 3049418 |
| Molecular Formula | C11H6Br2N4O2 |
| Molecular Weight | 386.00 g/mol |
| Exact Mass | 383.89 |
| IUPAC Name | methyl 3,5-dibromo-4-[2-(dicyanomethylidene)hydrazinyl]benzoate |
| SMILES | COC(=O)c1cc(Br)c(NN=C(C#N)C#N)c(Br)c1 |
| InChI | InChI=1S/C11H6Br2N4O2/c1-19-11(18)6-2-8(12)10(9(13)3-6)17-16-7(4-14)5-15/h2-3,17H,1H3 |
| InChIKey | TVMVOKNQGWKQDD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.00 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|