About (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride (PubChem CID 3049455) has the molecular formula C16H20ClNO3
and a molecular weight of 309.79 g/mol. Its IUPAC name is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride.
Molecular Properties
| Compound Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride |
| PubChem CID | 3049455 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride |
| SMILES | CN1C2CCC1CC(OC(=O)C(=O)c1ccccc1)C2.Cl |
| InChI | InChI=1S/C16H19NO3.ClH/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11;/h2-6,12-14H,7-10H2,1H3;1H |
| InChIKey | VCCPIBDMXOKTCP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride?
The IUPAC name of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride (CID 3049455) is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride.
What is the SMILES notation for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride?
The canonical SMILES for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride is CN1C2CCC1CC(OC(=O)C(=O)c1ccccc1)C2.Cl.
What is the InChIKey of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride?
The InChIKey is VCCPIBDMXOKTCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3.ClH/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11;/h2-6,12-14H,7-10H2,1H3;1H.
What are the key properties of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride?
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride has a molecular weight of 309.79 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-oxo-2-phenylacetate;hydrochloride is sourced from PubChem (CID 3049455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).