About 4-octylthiane 1,1-dioxide
4-octylthiane 1,1-dioxide (PubChem CID 3049463) has the molecular formula C13H26O2S
and a molecular weight of 246.42 g/mol. Its IUPAC name is 4-octylthiane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-octylthiane 1,1-dioxide |
| PubChem CID | 3049463 |
| Molecular Formula | C13H26O2S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 4-octylthiane 1,1-dioxide |
| SMILES | CCCCCCCCC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H26O2S/c1-2-3-4-5-6-7-8-13-9-11-16(14,15)12-10-13/h13H,2-12H2,1H3 |
| InChIKey | USHMEMWBBLJMFZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-octylthiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-octylthiane 1,1-dioxide?
The IUPAC name of 4-octylthiane 1,1-dioxide (CID 3049463) is 4-octylthiane 1,1-dioxide.
What is the SMILES notation for 4-octylthiane 1,1-dioxide?
The canonical SMILES for 4-octylthiane 1,1-dioxide is CCCCCCCCC1CCS(=O)(=O)CC1.
What is the InChIKey of 4-octylthiane 1,1-dioxide?
The InChIKey is USHMEMWBBLJMFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2S/c1-2-3-4-5-6-7-8-13-9-11-16(14,15)12-10-13/h13H,2-12H2,1H3.
What are the key properties of 4-octylthiane 1,1-dioxide?
4-octylthiane 1,1-dioxide has a molecular weight of 246.42 g/mol, XLogP of 3.56, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-octylthiane 1,1-dioxide is sourced from PubChem (CID 3049463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).