About N-hydroxy-N',N'-diphenylpropanediamide
N-hydroxy-N',N'-diphenylpropanediamide (PubChem CID 3049610) has the molecular formula C15H14N2O3
and a molecular weight of 270.29 g/mol. Its IUPAC name is N-hydroxy-N',N'-diphenylpropanediamide.
Molecular Properties
| Compound Name | N-hydroxy-N',N'-diphenylpropanediamide |
| PubChem CID | 3049610 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-hydroxy-N',N'-diphenylpropanediamide |
| SMILES | O=C(CC(=O)N(c1ccccc1)c1ccccc1)NO |
| InChI | InChI=1S/C15H14N2O3/c18-14(16-20)11-15(19)17(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,20H,11H2,(H,16,18) |
| InChIKey | RMOMHGUTSMSHDE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-N',N'-diphenylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-N',N'-diphenylpropanediamide?
The IUPAC name of N-hydroxy-N',N'-diphenylpropanediamide (CID 3049610) is N-hydroxy-N',N'-diphenylpropanediamide.
What is the SMILES notation for N-hydroxy-N',N'-diphenylpropanediamide?
The canonical SMILES for N-hydroxy-N',N'-diphenylpropanediamide is O=C(CC(=O)N(c1ccccc1)c1ccccc1)NO.
What is the InChIKey of N-hydroxy-N',N'-diphenylpropanediamide?
The InChIKey is RMOMHGUTSMSHDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3/c18-14(16-20)11-15(19)17(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,20H,11H2,(H,16,18).
What are the key properties of N-hydroxy-N',N'-diphenylpropanediamide?
N-hydroxy-N',N'-diphenylpropanediamide has a molecular weight of 270.29 g/mol, XLogP of 2.25, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-N',N'-diphenylpropanediamide is sourced from PubChem (CID 3049610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).