About 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine
3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine (PubChem CID 3049690) has the molecular formula C15H20ClN
and a molecular weight of 249.79 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine |
| PubChem CID | 3049690 |
| Molecular Formula | C15H20ClN |
| Molecular Weight | 249.79 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine |
| SMILES | CCCN(CC#Cc1ccc(Cl)cc1)CCC |
| InChI | InChI=1S/C15H20ClN/c1-3-11-17(12-4-2)13-5-6-14-7-9-15(16)10-8-14/h7-10H,3-4,11-13H2,1-2H3 |
| InChIKey | JQHCWKBZZGWSEN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.79 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine?
The IUPAC name of 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine (CID 3049690) is 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine.
What is the SMILES notation for 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine?
The canonical SMILES for 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine is CCCN(CC#Cc1ccc(Cl)cc1)CCC.
What is the InChIKey of 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine?
The InChIKey is JQHCWKBZZGWSEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClN/c1-3-11-17(12-4-2)13-5-6-14-7-9-15(16)10-8-14/h7-10H,3-4,11-13H2,1-2H3.
What are the key properties of 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine?
3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine has a molecular weight of 249.79 g/mol, XLogP of 3.81, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine is sourced from PubChem (CID 3049690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).