C14H21BrO2 — CID 30497
2-(4-bromophenyl)-4-ethylhexane-2,4-diol (PubChem CID 30497) has the molecular formula C14H21BrO2 and a molecular weight of 301.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-ethylhexane-2,4-diol.
| Compound Name | 2-(4-bromophenyl)-4-ethylhexane-2,4-diol |
|---|---|
| PubChem CID | 30497 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-(4-bromophenyl)-4-ethylhexane-2,4-diol |
| SMILES | CCC(O)(CC)CC(C)(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H21BrO2/c1-4-14(17,5-2)10-13(3,16)11-6-8-12(15)9-7-11/h6-9,16-17H,4-5,10H2,1-3H3 |
| InChIKey | LJESTSRMCGGACG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |