About 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide
2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide (PubChem CID 3049740) has the molecular formula C25H19IS
and a molecular weight of 478.40 g/mol. Its IUPAC name is 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide.
Molecular Properties
| Compound Name | 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide |
| PubChem CID | 3049740 |
| Molecular Formula | C25H19IS |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide |
| SMILES | [I-].c1ccc(-c2cc(-c3ccccc3)c3c([s+]2)-c2ccccc2CC3)cc1 |
| InChI | InChI=1S/C25H19S.HI/c1-3-9-18(10-4-1)23-17-24(20-12-5-2-6-13-20)26-25-21-14-8-7-11-19(21)15-16-22(23)25;/h1-14,17H,15-16H2;1H/q+1;/p-1 |
| InChIKey | ANDNJUAMAUVCEE-UHFFFAOYSA-M |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide?
The IUPAC name of 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide (CID 3049740) is 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide.
What is the SMILES notation for 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide?
The canonical SMILES for 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide is [I-].c1ccc(-c2cc(-c3ccccc3)c3c([s+]2)-c2ccccc2CC3)cc1.
What is the InChIKey of 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide?
The InChIKey is ANDNJUAMAUVCEE-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H19S.HI/c1-3-9-18(10-4-1)23-17-24(20-12-5-2-6-13-20)26-25-21-14-8-7-11-19(21)15-16-22(23)25;/h1-14,17H,15-16H2;1H/q+1;/p-1.
What are the key properties of 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide?
2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide has a molecular weight of 478.40 g/mol, XLogP of 4.13, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium iodide is sourced from PubChem (CID 3049740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).