C21H17ClO4S — CID 3049741
2-thioniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaene perchlorate (PubChem CID 3049741) has the molecular formula C21H17ClO4S and a molecular weight of 400.88 g/mol. Its IUPAC name is 2-thioniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaene perchlorate.
| Compound Name | 2-thioniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaene perchlorate |
|---|---|
| PubChem CID | 3049741 |
| Molecular Formula | C21H17ClO4S |
| Molecular Weight | 400.88 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 2-thioniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaene perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc2c(c1)CCc1cc3c([s+]c1-2)-c1ccccc1CC3 |
| InChI | InChI=1S/C21H17S.ClHO4/c1-3-7-18-14(5-1)9-11-16-13-17-12-10-15-6-2-4-8-19(15)21(17)22-20(16)18;2-1(3,4)5/h1-8,13H,9-12H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | IGZSGTYVDMCEOL-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.88 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|