About 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one
1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one (PubChem CID 3049904) has the molecular formula C18H22N2O2S
and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one.
Molecular Properties
| Compound Name | 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one |
| PubChem CID | 3049904 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCSC1c1ccccc1.C=CN1CCCC1=O |
| InChI | InChI=1S/C12H13NOS.C6H9NO/c1-2-11(14)13-8-9-15-12(13)10-6-4-3-5-7-10;1-2-7-5-3-4-6(7)8/h2-7,12H,1,8-9H2;2H,1,3-5H2 |
| InChIKey | BHPSMSSUOMFQSE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one?
The IUPAC name of 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one (CID 3049904) is 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one.
What is the SMILES notation for 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one?
The canonical SMILES for 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one is C=CC(=O)N1CCSC1c1ccccc1.C=CN1CCCC1=O.
What is the InChIKey of 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one?
The InChIKey is BHPSMSSUOMFQSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NOS.C6H9NO/c1-2-11(14)13-8-9-15-12(13)10-6-4-3-5-7-10;1-2-7-5-3-4-6(7)8/h2-7,12H,1,8-9H2;2H,1,3-5H2.
What are the key properties of 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one?
1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one has a molecular weight of 330.45 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpyrrolidin-2-one;1-(2-phenyl-1,3-thiazolidin-3-yl)prop-2-en-1-one is sourced from PubChem (CID 3049904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).