About 2-hydroxybenzoic acid;thieno[3,2-c]pyridine
2-hydroxybenzoic acid;thieno[3,2-c]pyridine (PubChem CID 3049962) has the molecular formula C14H11NO3S
and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;thieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;thieno[3,2-c]pyridine |
| PubChem CID | 3049962 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-hydroxybenzoic acid;thieno[3,2-c]pyridine |
| SMILES | O=C(O)c1ccccc1O.c1cc2sccc2cn1 |
| InChI | InChI=1S/C7H5NS.C7H6O3/c1-3-8-5-6-2-4-9-7(1)6;8-6-4-2-1-3-5(6)7(9)10/h1-5H;1-4,8H,(H,9,10) |
| InChIKey | WQUIHIYURLIXQY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxybenzoic acid;thieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;thieno[3,2-c]pyridine?
The IUPAC name of 2-hydroxybenzoic acid;thieno[3,2-c]pyridine (CID 3049962) is 2-hydroxybenzoic acid;thieno[3,2-c]pyridine.
What is the SMILES notation for 2-hydroxybenzoic acid;thieno[3,2-c]pyridine?
The canonical SMILES for 2-hydroxybenzoic acid;thieno[3,2-c]pyridine is O=C(O)c1ccccc1O.c1cc2sccc2cn1.
What is the InChIKey of 2-hydroxybenzoic acid;thieno[3,2-c]pyridine?
The InChIKey is WQUIHIYURLIXQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.C7H6O3/c1-3-8-5-6-2-4-9-7(1)6;8-6-4-2-1-3-5(6)7(9)10/h1-5H;1-4,8H,(H,9,10).
What are the key properties of 2-hydroxybenzoic acid;thieno[3,2-c]pyridine?
2-hydroxybenzoic acid;thieno[3,2-c]pyridine has a molecular weight of 273.31 g/mol, XLogP of 3.39, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;thieno[3,2-c]pyridine is sourced from PubChem (CID 3049962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).