C20H26IN3O — CID 3050064
trimethyl-[2-(5-oxo-1-phenyl-2,3-dihydro-1,4-benzodiazepin-4-yl)ethyl]azanium iodide (PubChem CID 3050064) has the molecular formula C20H26IN3O and a molecular weight of 451.35 g/mol. Its IUPAC name is trimethyl-[2-(5-oxo-1-phenyl-2,3-dihydro-1,4-benzodiazepin-4-yl)ethyl]azanium iodide.
| Compound Name | trimethyl-[2-(5-oxo-1-phenyl-2,3-dihydro-1,4-benzodiazepin-4-yl)ethyl]azanium iodide |
|---|---|
| PubChem CID | 3050064 |
| Molecular Formula | C20H26IN3O |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | trimethyl-[2-(5-oxo-1-phenyl-2,3-dihydro-1,4-benzodiazepin-4-yl)ethyl]azanium iodide |
| SMILES | C[N+](C)(C)CCN1CCN(c2ccccc2)c2ccccc2C1=O.[I-] |
| InChI | InChI=1S/C20H26N3O.HI/c1-23(2,3)16-15-21-13-14-22(17-9-5-4-6-10-17)19-12-8-7-11-18(19)20(21)24;/h4-12H,13-16H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | WTYPSKPUJJFFNE-UHFFFAOYSA-M |
| XLogP | -0.01 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|